C12H14O2 — CID 11412842
(1S,2R,6S,7R)-5-methoxy-4-methyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 11412842) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (1S,2R,6S,7R)-5-methoxy-4-methyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2R,6S,7R)-5-methoxy-4-methyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 11412842 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (1S,2R,6S,7R)-5-methoxy-4-methyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | COC1=C(C)C(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C12H14O2/c1-6-11(13)9-7-3-4-8(5-7)10(9)12(6)14-2/h3-4,7-10H,5H2,1-2H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | QKJACBGXBHOYOI-RGOKHQFPSA-N |
| XLogP | 1.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|