C9H10O2 — CID 91084393
4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-10-one (PubChem CID 91084393) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-10-one.
| Compound Name | 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-10-one |
|---|---|
| PubChem CID | 91084393 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-10-one |
| SMILES | O=C1C2=CCC1C1COCC21 |
| InChI | InChI=1S/C9H10O2/c10-9-5-1-2-6(9)8-4-11-3-7(5)8/h1,6-8H,2-4H2 |
| InChIKey | TWELLHGVRRNUTA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |