C9H6O4 — CID 91191206
4-oxatricyclo[5.2.1.02,6]dec-1(9)-ene-3,5,10-trione (PubChem CID 91191206) has the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. Its IUPAC name is 4-oxatricyclo[5.2.1.02,6]dec-1(9)-ene-3,5,10-trione.
| Compound Name | 4-oxatricyclo[5.2.1.02,6]dec-1(9)-ene-3,5,10-trione |
|---|---|
| PubChem CID | 91191206 |
| Molecular Formula | C9H6O4 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 4-oxatricyclo[5.2.1.02,6]dec-1(9)-ene-3,5,10-trione |
| SMILES | O=C1C2=CCC1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C9H6O4/c10-7-3-1-2-4(7)6-5(3)8(11)13-9(6)12/h1,4-6H,2H2 |
| InChIKey | LJGOCWFZTDOSMC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|