C12H19N3OS — CID 114129261
6-amino-N-(5-methylsulfanylpentyl)pyridine-2-carboxamide (PubChem CID 114129261) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 6-amino-N-(5-methylsulfanylpentyl)pyridine-2-carboxamide.
| Compound Name | 6-amino-N-(5-methylsulfanylpentyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114129261 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 6-amino-N-(5-methylsulfanylpentyl)pyridine-2-carboxamide |
| SMILES | CSCCCCCNC(=O)c1cccc(N)n1 |
| InChI | InChI=1S/C12H19N3OS/c1-17-9-4-2-3-8-14-12(16)10-6-5-7-11(13)15-10/h5-7H,2-4,8-9H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | JKMKDSGZGNBZJJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|