C10H11BrF4N2 — CID 114129629
4-bromo-5-fluoro-2-N-(4,4,4-trifluorobutan-2-yl)benzene-1,2-diamine (PubChem CID 114129629) has the molecular formula C10H11BrF4N2 and a molecular weight of 315.11 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-N-(4,4,4-trifluorobutan-2-yl)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-fluoro-2-N-(4,4,4-trifluorobutan-2-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114129629 |
| Molecular Formula | C10H11BrF4N2 |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 4-bromo-5-fluoro-2-N-(4,4,4-trifluorobutan-2-yl)benzene-1,2-diamine |
| SMILES | CC(CC(F)(F)F)Nc1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C10H11BrF4N2/c1-5(4-10(13,14)15)17-9-2-6(11)7(12)3-8(9)16/h2-3,5,17H,4,16H2,1H3 |
| InChIKey | OPVWESBNBUDWLL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|