C12H9NO2 — CID 11412966
2-methylbenzo[e][1,2]benzoxazol-1-one (PubChem CID 11412966) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-methylbenzo[e][1,2]benzoxazol-1-one.
| Compound Name | 2-methylbenzo[e][1,2]benzoxazol-1-one |
|---|---|
| PubChem CID | 11412966 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-methylbenzo[e][1,2]benzoxazol-1-one |
| SMILES | Cn1oc2ccc3ccccc3c2c1=O |
| InChI | InChI=1S/C12H9NO2/c1-13-12(14)11-9-5-3-2-4-8(9)6-7-10(11)15-13/h2-7H,1H3 |
| InChIKey | CEHIMSOEWHOGSK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |