C11H11ClF3N3 — CID 114129976
7-chloro-1-(4,4,4-trifluorobutan-2-yl)benzimidazol-2-amine (PubChem CID 114129976) has the molecular formula C11H11ClF3N3 and a molecular weight of 277.68 g/mol. Its IUPAC name is 7-chloro-1-(4,4,4-trifluorobutan-2-yl)benzimidazol-2-amine.
| Compound Name | 7-chloro-1-(4,4,4-trifluorobutan-2-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 114129976 |
| Molecular Formula | C11H11ClF3N3 |
| Molecular Weight | 277.68 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 7-chloro-1-(4,4,4-trifluorobutan-2-yl)benzimidazol-2-amine |
| SMILES | CC(CC(F)(F)F)n1c(N)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C11H11ClF3N3/c1-6(5-11(13,14)15)18-9-7(12)3-2-4-8(9)17-10(18)16/h2-4,6H,5H2,1H3,(H2,16,17) |
| InChIKey | ADGMVSYUTRJDRK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |