C13H16F3NO2 — CID 114130599
2-[2-[(4,4,4-trifluorobutan-2-ylamino)methyl]phenyl]acetic acid (PubChem CID 114130599) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-[2-[(4,4,4-trifluorobutan-2-ylamino)methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(4,4,4-trifluorobutan-2-ylamino)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 114130599 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-[2-[(4,4,4-trifluorobutan-2-ylamino)methyl]phenyl]acetic acid |
| SMILES | CC(CC(F)(F)F)NCc1ccccc1CC(=O)O |
| InChI | InChI=1S/C13H16F3NO2/c1-9(7-13(14,15)16)17-8-11-5-3-2-4-10(11)6-12(18)19/h2-5,9,17H,6-8H2,1H3,(H,18,19) |
| InChIKey | TWLTWNOBKBHDDT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |