C7H11NO6 — CID 11413061
(5R,6S,7S,8R,8aR)-5,6,7,8-tetrahydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 11413061) has the molecular formula C7H11NO6 and a molecular weight of 205.17 g/mol. Its IUPAC name is (5R,6S,7S,8R,8aR)-5,6,7,8-tetrahydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5R,6S,7S,8R,8aR)-5,6,7,8-tetrahydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 11413061 |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (5R,6S,7S,8R,8aR)-5,6,7,8-tetrahydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | O=C1OC[C@@H]2[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)N12 |
| InChI | InChI=1S/C7H11NO6/c9-3-2-1-14-7(13)8(2)6(12)5(11)4(3)10/h2-6,9-12H,1H2/t2-,3-,4+,5+,6-/m1/s1 |
| InChIKey | GAEMVFBCSZKQAJ-RWOPYEJCSA-N |
| XLogP | -2.78 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |