C7H11NO3 — CID 130763802
(4S,4aS)-4-hydroxy-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one (PubChem CID 130763802) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is (4S,4aS)-4-hydroxy-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one.
| Compound Name | (4S,4aS)-4-hydroxy-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 130763802 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (4S,4aS)-4-hydroxy-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
| SMILES | O=C1OC[C@@H](O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C7H11NO3/c9-6-4-11-7(10)8-3-1-2-5(6)8/h5-6,9H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | DLBGZXIYGSIUIE-NTSWFWBYSA-N |
| XLogP | -0.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |