C8H15NO2 — CID 67315688
[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-1-yl]methanol (PubChem CID 67315688) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-1-yl]methanol.
| Compound Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-1-yl]methanol |
|---|---|
| PubChem CID | 67315688 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-1-yl]methanol |
| SMILES | OCC1OCCN2CCC[C@@H]12 |
| InChI | InChI=1S/C8H15NO2/c10-6-8-7-2-1-3-9(7)4-5-11-8/h7-8,10H,1-6H2/t7-,8?/m0/s1 |
| InChIKey | BDNCVSVQKSBSJA-JAMMHHFISA-N |
| XLogP | -0.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |