C8H15NO2 — CID 11073680
(1R,2R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol (PubChem CID 11073680) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (1R,2R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol.
| Compound Name | (1R,2R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
|---|---|
| PubChem CID | 11073680 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (1R,2R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
| SMILES | O[C@H]1[C@H](O)CN2CCCC[C@@H]12 |
| InChI | InChI=1S/C8H15NO2/c10-7-5-9-4-2-1-3-6(9)8(7)11/h6-8,10-11H,1-5H2/t6-,7+,8+/m0/s1 |
| InChIKey | SQECYPINZNWUTE-XLPZGREQSA-N |
| XLogP | -0.42 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |