C11H16F3N3 — CID 114131334
2-N-ethyl-4-N-(4,4,4-trifluorobutan-2-yl)pyridine-2,4-diamine (PubChem CID 114131334) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-N-ethyl-4-N-(4,4,4-trifluorobutan-2-yl)pyridine-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-(4,4,4-trifluorobutan-2-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 114131334 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-N-ethyl-4-N-(4,4,4-trifluorobutan-2-yl)pyridine-2,4-diamine |
| SMILES | CCNc1cc(NC(C)CC(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H16F3N3/c1-3-15-10-6-9(4-5-16-10)17-8(2)7-11(12,13)14/h4-6,8H,3,7H2,1-2H3,(H2,15,16,17) |
| InChIKey | LDOOQDKOGMNZIO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |