C13H21N3O2 — CID 113367704
methyl 2-[[2-(ethylamino)-4-pyridinyl]amino]-3-methylbutanoate (PubChem CID 113367704) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 2-[[2-(ethylamino)-4-pyridinyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[2-(ethylamino)-4-pyridinyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 113367704 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | methyl 2-[[2-(ethylamino)-4-pyridinyl]amino]-3-methylbutanoate |
| SMILES | CCNc1cc(NC(C(=O)OC)C(C)C)ccn1 |
| InChI | InChI=1S/C13H21N3O2/c1-5-14-11-8-10(6-7-15-11)16-12(9(2)3)13(17)18-4/h6-9,12H,5H2,1-4H3,(H2,14,15,16) |
| InChIKey | JQWJLOMPRWPAAU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |