C10H14ClN3O2 — CID 129367589
methyl (2S)-2-[(2-chloropyrimidin-4-yl)amino]-3-methylbutanoate (PubChem CID 129367589) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is methyl (2S)-2-[(2-chloropyrimidin-4-yl)amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(2-chloropyrimidin-4-yl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 129367589 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | methyl (2S)-2-[(2-chloropyrimidin-4-yl)amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](Nc1ccnc(Cl)n1)C(C)C |
| InChI | InChI=1S/C10H14ClN3O2/c1-6(2)8(9(15)16-3)13-7-4-5-12-10(11)14-7/h4-6,8H,1-3H3,(H,12,13,14)/t8-/m0/s1 |
| InChIKey | UQNYQBDUOQZQRZ-QMMMGPOBSA-N |
| XLogP | 1.74 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |