C10H17ClN4 — CID 130469662
(3S)-3-N-(2-chloropyrimidin-4-yl)-4-methylpentane-2,3-diamine (PubChem CID 130469662) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is (3S)-3-N-(2-chloropyrimidin-4-yl)-4-methylpentane-2,3-diamine.
| Compound Name | (3S)-3-N-(2-chloropyrimidin-4-yl)-4-methylpentane-2,3-diamine |
|---|---|
| PubChem CID | 130469662 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (3S)-3-N-(2-chloropyrimidin-4-yl)-4-methylpentane-2,3-diamine |
| SMILES | CC(C)[C@H](Nc1ccnc(Cl)n1)C(C)N |
| InChI | InChI=1S/C10H17ClN4/c1-6(2)9(7(3)12)14-8-4-5-13-10(11)15-8/h4-7,9H,12H2,1-3H3,(H,13,14,15)/t7?,9-/m0/s1 |
| InChIKey | UIVMSMGMPLUZMM-NETXQHHPSA-N |
| XLogP | 1.91 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |