C13H20ClN3O2 — CID 80953741
methyl 2-[(6-chloro-2-propan-2-ylpyrimidin-4-yl)amino]-3-methylbutanoate (PubChem CID 80953741) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is methyl 2-[(6-chloro-2-propan-2-ylpyrimidin-4-yl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(6-chloro-2-propan-2-ylpyrimidin-4-yl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 80953741 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 2-[(6-chloro-2-propan-2-ylpyrimidin-4-yl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(Nc1cc(Cl)nc(C(C)C)n1)C(C)C |
| InChI | InChI=1S/C13H20ClN3O2/c1-7(2)11(13(18)19-5)16-10-6-9(14)15-12(17-10)8(3)4/h6-8,11H,1-5H3,(H,15,16,17) |
| InChIKey | OLMOKBOHSCXAIP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |