C24H28ClN3O3Si — CID 145392940
methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-chloropyrimidin-4-yl)amino]propanoate (PubChem CID 145392940) has the molecular formula C24H28ClN3O3Si and a molecular weight of 470.05 g/mol. Its IUPAC name is methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-chloropyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-chloropyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 145392940 |
| Molecular Formula | C24H28ClN3O3Si |
| Molecular Weight | 470.05 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | methyl (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-chloropyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C24H28ClN3O3Si/c1-24(2,3)32(18-11-7-5-8-12-18,19-13-9-6-10-14-19)31-17-20(22(29)30-4)27-21-15-16-26-23(25)28-21/h5-16,20H,17H2,1-4H3,(H,26,27,28)/t20-/m1/s1 |
| InChIKey | ZQZBRPOWGOHHSI-HXUWFJFHSA-N |
| XLogP | 3.66 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.05 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|