C11H11BrF3NO2 — CID 114131875
2-bromo-6-(4,4,4-trifluorobutan-2-ylamino)benzoic acid (PubChem CID 114131875) has the molecular formula C11H11BrF3NO2 and a molecular weight of 326.11 g/mol. Its IUPAC name is 2-bromo-6-(4,4,4-trifluorobutan-2-ylamino)benzoic acid.
| Compound Name | 2-bromo-6-(4,4,4-trifluorobutan-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 114131875 |
| Molecular Formula | C11H11BrF3NO2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-bromo-6-(4,4,4-trifluorobutan-2-ylamino)benzoic acid |
| SMILES | CC(CC(F)(F)F)Nc1cccc(Br)c1C(=O)O |
| InChI | InChI=1S/C11H11BrF3NO2/c1-6(5-11(13,14)15)16-8-4-2-3-7(12)9(8)10(17)18/h2-4,6,16H,5H2,1H3,(H,17,18) |
| InChIKey | LPCTZWIJQWVPER-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |