C11H9BrF3NO2 — CID 114159520
2-bromo-6-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid (PubChem CID 114159520) has the molecular formula C11H9BrF3NO2 and a molecular weight of 324.10 g/mol. Its IUPAC name is 2-bromo-6-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid.
| Compound Name | 2-bromo-6-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid |
|---|---|
| PubChem CID | 114159520 |
| Molecular Formula | C11H9BrF3NO2 |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2-bromo-6-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid |
| SMILES | O=C(O)c1c(Br)cccc1NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H9BrF3NO2/c12-6-2-1-3-7(8(6)9(17)18)16-10(4-5-10)11(13,14)15/h1-3,16H,4-5H2,(H,17,18) |
| InChIKey | UIDVTACVDDRFKJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |