C13H16N2O4 — CID 114132536
2-[[2-[ethyl(methyl)amino]-2-oxoethyl]carbamoyl]benzoic acid (PubChem CID 114132536) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[[2-[ethyl(methyl)amino]-2-oxoethyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[2-[ethyl(methyl)amino]-2-oxoethyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 114132536 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[[2-[ethyl(methyl)amino]-2-oxoethyl]carbamoyl]benzoic acid |
| SMILES | CCN(C)C(=O)CNC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C13H16N2O4/c1-3-15(2)11(16)8-14-12(17)9-6-4-5-7-10(9)13(18)19/h4-7H,3,8H2,1-2H3,(H,14,17)(H,18,19) |
| InChIKey | OJOHKVNJTRPTJP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |