C12H24O3 — CID 11413287
(3S)-3-hydroxy-2,2-dimethyldecanoic acid (PubChem CID 11413287) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (3S)-3-hydroxy-2,2-dimethyldecanoic acid.
| Compound Name | (3S)-3-hydroxy-2,2-dimethyldecanoic acid |
|---|---|
| PubChem CID | 11413287 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (3S)-3-hydroxy-2,2-dimethyldecanoic acid |
| SMILES | CCCCCCC[C@H](O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H24O3/c1-4-5-6-7-8-9-10(13)12(2,3)11(14)15/h10,13H,4-9H2,1-3H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | HMAWNZOEPYGUJU-JTQLQIEISA-N |
| XLogP | 2.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|