C9H19NO3 — CID 44817672
(2R,3S)-2-amino-3-hydroxy-2-methyloctanoic acid (PubChem CID 44817672) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-hydroxy-2-methyloctanoic acid.
| Compound Name | (2R,3S)-2-amino-3-hydroxy-2-methyloctanoic acid |
|---|---|
| PubChem CID | 44817672 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (2R,3S)-2-amino-3-hydroxy-2-methyloctanoic acid |
| SMILES | CCCCC[C@H](O)[C@@](C)(N)C(=O)O |
| InChI | InChI=1S/C9H19NO3/c1-3-4-5-6-7(11)9(2,10)8(12)13/h7,11H,3-6,10H2,1-2H3,(H,12,13)/t7-,9+/m0/s1 |
| InChIKey | WQXVCJPMLCLWMO-IONNQARKSA-N |
| XLogP | 0.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|