C21H41NO5 — CID 10834102
(2S,3S)-2-amino-3-hydroxy-2-(hydroxymethyl)-14-oxoicosanoic acid (PubChem CID 10834102) has the molecular formula C21H41NO5 and a molecular weight of 387.56 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-hydroxy-2-(hydroxymethyl)-14-oxoicosanoic acid.
| Compound Name | (2S,3S)-2-amino-3-hydroxy-2-(hydroxymethyl)-14-oxoicosanoic acid |
|---|---|
| PubChem CID | 10834102 |
| Molecular Formula | C21H41NO5 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | (2S,3S)-2-amino-3-hydroxy-2-(hydroxymethyl)-14-oxoicosanoic acid |
| SMILES | CCCCCCC(=O)CCCCCCCCCC[C@H](O)[C@@](N)(CO)C(=O)O |
| InChI | InChI=1S/C21H41NO5/c1-2-3-4-11-14-18(24)15-12-9-7-5-6-8-10-13-16-19(25)21(22,17-23)20(26)27/h19,23,25H,2-17,22H2,1H3,(H,26,27)/t19-,21-/m0/s1 |
| InChIKey | JVVUMRUWQBAVNC-FPOVZHCZSA-N |
| XLogP | 3.56 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|