C21H39NO5 — CID 24798244
(E)-2-amino-3-hydroxy-2-(hydroxymethyl)-13-oxoicos-6-enoic acid (PubChem CID 24798244) has the molecular formula C21H39NO5 and a molecular weight of 385.55 g/mol. Its IUPAC name is (E)-2-amino-3-hydroxy-2-(hydroxymethyl)-13-oxoicos-6-enoic acid.
| Compound Name | (E)-2-amino-3-hydroxy-2-(hydroxymethyl)-13-oxoicos-6-enoic acid |
|---|---|
| PubChem CID | 24798244 |
| Molecular Formula | C21H39NO5 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | (E)-2-amino-3-hydroxy-2-(hydroxymethyl)-13-oxoicos-6-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCC/C=C/CCC(O)C(N)(CO)C(=O)O |
| InChI | InChI=1S/C21H39NO5/c1-2-3-4-8-11-14-18(24)15-12-9-6-5-7-10-13-16-19(25)21(22,17-23)20(26)27/h7,10,19,23,25H,2-6,8-9,11-17,22H2,1H3,(H,26,27)/b10-7+ |
| InChIKey | FZIVEXUNHNOCBY-JXMROGBWSA-N |
| XLogP | 3.34 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|