C13H27N3O — CID 114133096
N-butan-2-yl-2-[2-[cyclopropyl(methyl)amino]propylamino]acetamide (PubChem CID 114133096) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is N-butan-2-yl-2-[2-[cyclopropyl(methyl)amino]propylamino]acetamide.
| Compound Name | N-butan-2-yl-2-[2-[cyclopropyl(methyl)amino]propylamino]acetamide |
|---|---|
| PubChem CID | 114133096 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | N-butan-2-yl-2-[2-[cyclopropyl(methyl)amino]propylamino]acetamide |
| SMILES | CCC(C)NC(=O)CNCC(C)N(C)C1CC1 |
| InChI | InChI=1S/C13H27N3O/c1-5-10(2)15-13(17)9-14-8-11(3)16(4)12-6-7-12/h10-12,14H,5-9H2,1-4H3,(H,15,17) |
| InChIKey | JWUHWGRIABASIV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |