C12H22N4O — CID 114138299
1-[(1-methylpyrrolidin-2-yl)methylamino]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 114138299) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(1-methylpyrrolidin-2-yl)methylamino]-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | 1-[(1-methylpyrrolidin-2-yl)methylamino]-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 114138299 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-[(1-methylpyrrolidin-2-yl)methylamino]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | CN1CCCC1CNCC(O)Cn1cccn1 |
| InChI | InChI=1S/C12H22N4O/c1-15-6-2-4-11(15)8-13-9-12(17)10-16-7-3-5-14-16/h3,5,7,11-13,17H,2,4,6,8-10H2,1H3 |
| InChIKey | VDPOWKSZMJVGEM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |