C13H24N4O2 — CID 115626302
1-[(4-ethylmorpholin-2-yl)methylamino]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 115626302) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[(4-ethylmorpholin-2-yl)methylamino]-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | 1-[(4-ethylmorpholin-2-yl)methylamino]-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 115626302 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-[(4-ethylmorpholin-2-yl)methylamino]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | CCN1CCOC(CNCC(O)Cn2cccn2)C1 |
| InChI | InChI=1S/C13H24N4O2/c1-2-16-6-7-19-13(11-16)9-14-8-12(18)10-17-5-3-4-15-17/h3-5,12-14,18H,2,6-11H2,1H3 |
| InChIKey | MEPPNQUBFPZXMC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |