C17H25N3O3 — CID 100844104
4-[(2R)-3-[[(2R)-4-ethylmorpholin-2-yl]methylamino]-2-hydroxypropoxy]benzonitrile (PubChem CID 100844104) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-[(2R)-3-[[(2R)-4-ethylmorpholin-2-yl]methylamino]-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[(2R)-3-[[(2R)-4-ethylmorpholin-2-yl]methylamino]-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 100844104 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 4-[(2R)-3-[[(2R)-4-ethylmorpholin-2-yl]methylamino]-2-hydroxypropoxy]benzonitrile |
| SMILES | CCN1CCO[C@H](CNC[C@@H](O)COc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-20-7-8-22-17(12-20)11-19-10-15(21)13-23-16-5-3-14(9-18)4-6-16/h3-6,15,17,19,21H,2,7-8,10-13H2,1H3/t15-,17-/m1/s1 |
| InChIKey | QLSIQJPOOKWLEB-NVXWUHKLSA-N |
| XLogP | 0.61 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |