C14H19ClN2S — CID 114140415
2-[2-(5-chlorothiophen-2-yl)ethylamino]cycloheptane-1-carbonitrile (PubChem CID 114140415) has the molecular formula C14H19ClN2S and a molecular weight of 282.84 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)ethylamino]cycloheptane-1-carbonitrile.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)ethylamino]cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 114140415 |
| Molecular Formula | C14H19ClN2S |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)ethylamino]cycloheptane-1-carbonitrile |
| SMILES | N#CC1CCCCCC1NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H19ClN2S/c15-14-7-6-12(18-14)8-9-17-13-5-3-1-2-4-11(13)10-16/h6-7,11,13,17H,1-5,8-9H2 |
| InChIKey | HJKUQUFMPKUVMS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |