C14H20ClNS — CID 114227927
(2E)-N-[2-(5-chlorothiophen-2-yl)ethyl]cyclooct-2-en-1-amine (PubChem CID 114227927) has the molecular formula C14H20ClNS and a molecular weight of 269.84 g/mol. Its IUPAC name is (2E)-N-[2-(5-chlorothiophen-2-yl)ethyl]cyclooct-2-en-1-amine.
| Compound Name | (2E)-N-[2-(5-chlorothiophen-2-yl)ethyl]cyclooct-2-en-1-amine |
|---|---|
| PubChem CID | 114227927 |
| Molecular Formula | C14H20ClNS |
| Molecular Weight | 269.84 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2E)-N-[2-(5-chlorothiophen-2-yl)ethyl]cyclooct-2-en-1-amine |
| SMILES | Clc1ccc(CCNC2/C=C\CCCCC2)s1 |
| InChI | InChI=1S/C14H20ClNS/c15-14-9-8-13(17-14)10-11-16-12-6-4-2-1-3-5-7-12/h4,6,8-9,12,16H,1-3,5,7,10-11H2/b6-4- |
| InChIKey | VQZZOXFDJJDVSW-XQRVVYSFSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|