C15H21NO — CID 114227893
2-[[[(2E)-cyclooct-2-en-1-yl]amino]methyl]phenol (PubChem CID 114227893) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-[[[(2E)-cyclooct-2-en-1-yl]amino]methyl]phenol.
| Compound Name | 2-[[[(2E)-cyclooct-2-en-1-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 114227893 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-[[[(2E)-cyclooct-2-en-1-yl]amino]methyl]phenol |
| SMILES | Oc1ccccc1CNC1/C=C\CCCCC1 |
| InChI | InChI=1S/C15H21NO/c17-15-11-7-6-8-13(15)12-16-14-9-4-2-1-3-5-10-14/h4,6-9,11,14,16-17H,1-3,5,10,12H2/b9-4- |
| InChIKey | FNCBYEOOUHIBMC-WTKPLQERSA-N |
| XLogP | 3.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|