C13H16ClNO — CID 115693366
4-chloro-2-[(cyclohex-2-en-1-ylamino)methyl]phenol (PubChem CID 115693366) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 4-chloro-2-[(cyclohex-2-en-1-ylamino)methyl]phenol.
| Compound Name | 4-chloro-2-[(cyclohex-2-en-1-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 115693366 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-chloro-2-[(cyclohex-2-en-1-ylamino)methyl]phenol |
| SMILES | Oc1ccc(Cl)cc1CNC1C=CCCC1 |
| InChI | InChI=1S/C13H16ClNO/c14-11-6-7-13(16)10(8-11)9-15-12-4-2-1-3-5-12/h2,4,6-8,12,15-16H,1,3,5,9H2 |
| InChIKey | KKDISKYIWRKHMX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|