C11H20N2O2S2 — CID 114140725
2-(propylamino)-N-(2-thiophen-3-ylethyl)ethanesulfonamide (PubChem CID 114140725) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-(propylamino)-N-(2-thiophen-3-ylethyl)ethanesulfonamide.
| Compound Name | 2-(propylamino)-N-(2-thiophen-3-ylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 114140725 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(propylamino)-N-(2-thiophen-3-ylethyl)ethanesulfonamide |
| SMILES | CCCNCCS(=O)(=O)NCCc1ccsc1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-2-5-12-7-9-17(14,15)13-6-3-11-4-8-16-10-11/h4,8,10,12-13H,2-3,5-7,9H2,1H3 |
| InChIKey | YZTSWYHMPHEOHI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|