C14H18N2O2S2 — CID 106049833
1-[3-(aminomethyl)phenyl]-N-(2-thiophen-3-ylethyl)methanesulfonamide (PubChem CID 106049833) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-N-(2-thiophen-3-ylethyl)methanesulfonamide.
| Compound Name | 1-[3-(aminomethyl)phenyl]-N-(2-thiophen-3-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 106049833 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-N-(2-thiophen-3-ylethyl)methanesulfonamide |
| SMILES | NCc1cccc(CS(=O)(=O)NCCc2ccsc2)c1 |
| InChI | InChI=1S/C14H18N2O2S2/c15-9-13-2-1-3-14(8-13)11-20(17,18)16-6-4-12-5-7-19-10-12/h1-3,5,7-8,10,16H,4,6,9,11,15H2 |
| InChIKey | WPSUGSNJKIIEJM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |