C12H23N3O2S — CID 114141293
5-(aminomethyl)-N-(3-ethylpentan-2-yl)-1H-pyrrole-3-sulfonamide (PubChem CID 114141293) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(3-ethylpentan-2-yl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(3-ethylpentan-2-yl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 114141293 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-(aminomethyl)-N-(3-ethylpentan-2-yl)-1H-pyrrole-3-sulfonamide |
| SMILES | CCC(CC)C(C)NS(=O)(=O)c1c[nH]c(CN)c1 |
| InChI | InChI=1S/C12H23N3O2S/c1-4-10(5-2)9(3)15-18(16,17)12-6-11(7-13)14-8-12/h6,8-10,14-15H,4-5,7,13H2,1-3H3 |
| InChIKey | LTRQUWPQWDJSBR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |