C10H19N3O2S — CID 106046504
5-(aminomethyl)-N-pentan-2-yl-1H-pyrrole-3-sulfonamide (PubChem CID 106046504) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 5-(aminomethyl)-N-pentan-2-yl-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-pentan-2-yl-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106046504 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-(aminomethyl)-N-pentan-2-yl-1H-pyrrole-3-sulfonamide |
| SMILES | CCCC(C)NS(=O)(=O)c1c[nH]c(CN)c1 |
| InChI | InChI=1S/C10H19N3O2S/c1-3-4-8(2)13-16(14,15)10-5-9(6-11)12-7-10/h5,7-8,12-13H,3-4,6,11H2,1-2H3 |
| InChIKey | NYWLFQMRWXKKFL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |