C11H21N3O2S2 — CID 114142080
5-(ethylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)-1H-pyrrole-3-sulfonamide (PubChem CID 114142080) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 114142080 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-(ethylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)-1H-pyrrole-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NC(C)CSC)c[nH]1 |
| InChI | InChI=1S/C11H21N3O2S2/c1-4-12-6-10-5-11(7-13-10)18(15,16)14-9(2)8-17-3/h5,7,9,12-14H,4,6,8H2,1-3H3 |
| InChIKey | MILBMQUAXLESFH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |