C9H19F3N2O3S — CID 114141365
3-(ethylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1-sulfonamide (PubChem CID 114141365) has the molecular formula C9H19F3N2O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-(ethylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1-sulfonamide.
| Compound Name | 3-(ethylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 114141365 |
| Molecular Formula | C9H19F3N2O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-(ethylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]propane-1-sulfonamide |
| SMILES | CCNCCCS(=O)(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C9H19F3N2O3S/c1-2-13-4-3-7-18(15,16)14-5-6-17-8-9(10,11)12/h13-14H,2-8H2,1H3 |
| InChIKey | JBCZWAYIIWCAIB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|