C10H21N5O2S — CID 114141849
N',N',3,5-tetramethyl-1-[2-(methylamino)ethyl]pyrazole-4-sulfonohydrazide (PubChem CID 114141849) has the molecular formula C10H21N5O2S and a molecular weight of 275.38 g/mol. Its IUPAC name is N',N',3,5-tetramethyl-1-[2-(methylamino)ethyl]pyrazole-4-sulfonohydrazide.
| Compound Name | N',N',3,5-tetramethyl-1-[2-(methylamino)ethyl]pyrazole-4-sulfonohydrazide |
|---|---|
| PubChem CID | 114141849 |
| Molecular Formula | C10H21N5O2S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N',N',3,5-tetramethyl-1-[2-(methylamino)ethyl]pyrazole-4-sulfonohydrazide |
| SMILES | CNCCn1nc(C)c(S(=O)(=O)NN(C)C)c1C |
| InChI | InChI=1S/C10H21N5O2S/c1-8-10(18(16,17)13-14(4)5)9(2)15(12-8)7-6-11-3/h11,13H,6-7H2,1-5H3 |
| InChIKey | QHGOZRHQUSUBOC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|