C14H28N4O2S — CID 106030085
1-[2-(ethylamino)ethyl]-3,5-dimethyl-N-(3-methylbutan-2-yl)pyrazole-4-sulfonamide (PubChem CID 106030085) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-[2-(ethylamino)ethyl]-3,5-dimethyl-N-(3-methylbutan-2-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-[2-(ethylamino)ethyl]-3,5-dimethyl-N-(3-methylbutan-2-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106030085 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[2-(ethylamino)ethyl]-3,5-dimethyl-N-(3-methylbutan-2-yl)pyrazole-4-sulfonamide |
| SMILES | CCNCCn1nc(C)c(S(=O)(=O)NC(C)C(C)C)c1C |
| InChI | InChI=1S/C14H28N4O2S/c1-7-15-8-9-18-13(6)14(12(5)16-18)21(19,20)17-11(4)10(2)3/h10-11,15,17H,7-9H2,1-6H3 |
| InChIKey | HAHQQBSSYCKDSV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|