C12H28N2O2S — CID 114142376
N-(3,3-dimethylbutyl)-1-(propylamino)propane-2-sulfonamide (PubChem CID 114142376) has the molecular formula C12H28N2O2S and a molecular weight of 264.43 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-1-(propylamino)propane-2-sulfonamide.
| Compound Name | N-(3,3-dimethylbutyl)-1-(propylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 114142376 |
| Molecular Formula | C12H28N2O2S |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | N-(3,3-dimethylbutyl)-1-(propylamino)propane-2-sulfonamide |
| SMILES | CCCNCC(C)S(=O)(=O)NCCC(C)(C)C |
| InChI | InChI=1S/C12H28N2O2S/c1-6-8-13-10-11(2)17(15,16)14-9-7-12(3,4)5/h11,13-14H,6-10H2,1-5H3 |
| InChIKey | FFVLWLHLAACBOY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|