C12H22N6O2 — CID 114143246
3-[[2-(ethoxymethyl)-6-hydrazinylpyrimidin-4-yl]amino]-3-methylbutanamide (PubChem CID 114143246) has the molecular formula C12H22N6O2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 3-[[2-(ethoxymethyl)-6-hydrazinylpyrimidin-4-yl]amino]-3-methylbutanamide.
| Compound Name | 3-[[2-(ethoxymethyl)-6-hydrazinylpyrimidin-4-yl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 114143246 |
| Molecular Formula | C12H22N6O2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3-[[2-(ethoxymethyl)-6-hydrazinylpyrimidin-4-yl]amino]-3-methylbutanamide |
| SMILES | CCOCc1nc(NN)cc(NC(C)(C)CC(N)=O)n1 |
| InChI | InChI=1S/C12H22N6O2/c1-4-20-7-11-15-9(5-10(16-11)18-14)17-12(2,3)6-8(13)19/h5H,4,6-7,14H2,1-3H3,(H2,13,19)(H2,15,16,17,18) |
| InChIKey | OMFZHQMKMVGDQP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|