C13H26N6O2 — CID 106150364
1-(dimethylamino)-3-[[2-(ethoxymethyl)-6-hydrazinylpyrimidin-4-yl]amino]-2-methylpropan-2-ol (PubChem CID 106150364) has the molecular formula C13H26N6O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[[2-(ethoxymethyl)-6-hydrazinylpyrimidin-4-yl]amino]-2-methylpropan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[[2-(ethoxymethyl)-6-hydrazinylpyrimidin-4-yl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106150364 |
| Molecular Formula | C13H26N6O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 1-(dimethylamino)-3-[[2-(ethoxymethyl)-6-hydrazinylpyrimidin-4-yl]amino]-2-methylpropan-2-ol |
| SMILES | CCOCc1nc(NN)cc(NCC(C)(O)CN(C)C)n1 |
| InChI | InChI=1S/C13H26N6O2/c1-5-21-7-12-16-10(6-11(17-12)18-14)15-8-13(2,20)9-19(3)4/h6,20H,5,7-9,14H2,1-4H3,(H2,15,16,17,18) |
| InChIKey | MHMDXJDHQLBFFS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|