C13H23ClN4O2 — CID 106149394
1-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]amino]-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 106149394) has the molecular formula C13H23ClN4O2 and a molecular weight of 302.81 g/mol. Its IUPAC name is 1-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]amino]-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]amino]-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106149394 |
| Molecular Formula | C13H23ClN4O2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]amino]-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | CCOCc1nc(Cl)cc(NCC(C)(O)CN(C)C)n1 |
| InChI | InChI=1S/C13H23ClN4O2/c1-5-20-7-12-16-10(14)6-11(17-12)15-8-13(2,19)9-18(3)4/h6,19H,5,7-9H2,1-4H3,(H,15,16,17) |
| InChIKey | UPLXXKATIGOJLP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |