C12H23N5O — CID 106150185
1-(dimethylamino)-2-methyl-3-[[2-methyl-6-(methylamino)pyrimidin-4-yl]amino]propan-2-ol (PubChem CID 106150185) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-(dimethylamino)-2-methyl-3-[[2-methyl-6-(methylamino)pyrimidin-4-yl]amino]propan-2-ol.
| Compound Name | 1-(dimethylamino)-2-methyl-3-[[2-methyl-6-(methylamino)pyrimidin-4-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 106150185 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 1-(dimethylamino)-2-methyl-3-[[2-methyl-6-(methylamino)pyrimidin-4-yl]amino]propan-2-ol |
| SMILES | CNc1cc(NCC(C)(O)CN(C)C)nc(C)n1 |
| InChI | InChI=1S/C12H23N5O/c1-9-15-10(13-3)6-11(16-9)14-7-12(2,18)8-17(4)5/h6,18H,7-8H2,1-5H3,(H2,13,14,15,16) |
| InChIKey | NBDQIDAPHKJAFH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |