C11H12FIN2O4 — CID 114144734
3-[(4-fluoro-2-iodophenyl)carbamoylamino]-2-methoxypropanoic acid (PubChem CID 114144734) has the molecular formula C11H12FIN2O4 and a molecular weight of 382.13 g/mol. Its IUPAC name is 3-[(4-fluoro-2-iodophenyl)carbamoylamino]-2-methoxypropanoic acid.
| Compound Name | 3-[(4-fluoro-2-iodophenyl)carbamoylamino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 114144734 |
| Molecular Formula | C11H12FIN2O4 |
| Molecular Weight | 382.13 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 3-[(4-fluoro-2-iodophenyl)carbamoylamino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)Nc1ccc(F)cc1I)C(=O)O |
| InChI | InChI=1S/C11H12FIN2O4/c1-19-9(10(16)17)5-14-11(18)15-8-3-2-6(12)4-7(8)13/h2-4,9H,5H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | SPHCWLDVTCRLGU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.13 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|