C10H17BrF3NO2S — CID 114148184
N-[(3-bromocyclopentyl)methyl]-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 114148184) has the molecular formula C10H17BrF3NO2S and a molecular weight of 352.22 g/mol. Its IUPAC name is N-[(3-bromocyclopentyl)methyl]-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-[(3-bromocyclopentyl)methyl]-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 114148184 |
| Molecular Formula | C10H17BrF3NO2S |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | N-[(3-bromocyclopentyl)methyl]-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCC1CCC(Br)C1 |
| InChI | InChI=1S/C10H17BrF3NO2S/c11-9-3-2-8(6-9)7-15-18(16,17)5-1-4-10(12,13)14/h8-9,15H,1-7H2 |
| InChIKey | YYHNOXWMYLIMFU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|