C11H19BrF3NO2S — CID 83058945
N-[[2-(bromomethyl)cyclopentyl]methyl]-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83058945) has the molecular formula C11H19BrF3NO2S and a molecular weight of 366.24 g/mol. Its IUPAC name is N-[[2-(bromomethyl)cyclopentyl]methyl]-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-[[2-(bromomethyl)cyclopentyl]methyl]-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83058945 |
| Molecular Formula | C11H19BrF3NO2S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-[[2-(bromomethyl)cyclopentyl]methyl]-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCC1CCCC1CBr |
| InChI | InChI=1S/C11H19BrF3NO2S/c12-7-9-3-1-4-10(9)8-16-19(17,18)6-2-5-11(13,14)15/h9-10,16H,1-8H2 |
| InChIKey | XLYNSFIJHCQOCZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|