About butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol
butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol (PubChem CID 11415400) has the molecular formula C16H26MnNO-
and a molecular weight of 303.33 g/mol. Its IUPAC name is butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol.
Molecular Properties
| Compound Name | butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol |
| PubChem CID | 11415400 |
| Molecular Formula | C16H26MnNO- |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol |
| SMILES | CCC(O)=C(C)C.CCCC[N-]c1ccccc1.[Mn] |
| InChI | InChI=1S/C10H14N.C6H12O.Mn/c1-2-3-9-11-10-7-5-4-6-8-10;1-4-6(7)5(2)3;/h4-8H,2-3,9H2,1H3;7H,4H2,1-3H3;/q-1;; |
| InChIKey | IPSLVUNKAQRUKI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol?
The IUPAC name of butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol (CID 11415400) is butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol.
What is the SMILES notation for butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol?
The canonical SMILES for butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol is CCC(O)=C(C)C.CCCC[N-]c1ccccc1.[Mn].
What is the InChIKey of butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol?
The InChIKey is IPSLVUNKAQRUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N.C6H12O.Mn/c1-2-3-9-11-10-7-5-4-6-8-10;1-4-6(7)5(2)3;/h4-8H,2-3,9H2,1H3;7H,4H2,1-3H3;/q-1;;.
What are the key properties of butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol?
butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol has a molecular weight of 303.33 g/mol, XLogP of 5.74, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(phenyl)azanide;manganese;2-methylpent-2-en-3-ol is sourced from PubChem (CID 11415400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).